C12H14N4O — CID 104733726
1-pyrazolo[1,5-a]pyrazin-4-ylpiperidine-2-carbaldehyde (PubChem CID 104733726) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyrazin-4-ylpiperidine-2-carbaldehyde.
| Compound Name | 1-pyrazolo[1,5-a]pyrazin-4-ylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 104733726 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyrazin-4-ylpiperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1c1nccn2nccc12 |
| InChI | InChI=1S/C12H14N4O/c17-9-10-3-1-2-7-15(10)12-11-4-5-14-16(11)8-6-13-12/h4-6,8-10H,1-3,7H2 |
| InChIKey | GHSZLXZMBKQIDL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|