C13H14N2O2 — CID 106535618
1-furo[3,2-c]pyridin-4-ylpiperidine-2-carbaldehyde (PubChem CID 106535618) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-furo[3,2-c]pyridin-4-ylpiperidine-2-carbaldehyde.
| Compound Name | 1-furo[3,2-c]pyridin-4-ylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 106535618 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-furo[3,2-c]pyridin-4-ylpiperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1c1nccc2occc12 |
| InChI | InChI=1S/C13H14N2O2/c16-9-10-3-1-2-7-15(10)13-11-5-8-17-12(11)4-6-14-13/h4-6,8-10H,1-3,7H2 |
| InChIKey | WMIVJSXPRLSJRY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|