C12H13N3O — CID 62663072
2-(2-formylpiperidin-1-yl)pyridine-3-carbonitrile (PubChem CID 62663072) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-(2-formylpiperidin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 2-(2-formylpiperidin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 62663072 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(2-formylpiperidin-1-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCCCC1C=O |
| InChI | InChI=1S/C12H13N3O/c13-8-10-4-3-6-14-12(10)15-7-2-1-5-11(15)9-16/h3-4,6,9,11H,1-2,5,7H2 |
| InChIKey | UVHJKJSNFJBCMD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|