C11H12N4O — CID 43183688
1-(3-cyano-2-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 43183688) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-(3-cyano-2-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(3-cyano-2-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43183688 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-(3-cyano-2-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | N#Cc1cccnc1N1CCCC1C(N)=O |
| InChI | InChI=1S/C11H12N4O/c12-7-8-3-1-5-14-11(8)15-6-2-4-9(15)10(13)16/h1,3,5,9H,2,4,6H2,(H2,13,16) |
| InChIKey | SAPAJOLOQVDKHG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |