C17H17N3 — CID 47299056
2-[2-(3-methylphenyl)pyrrolidin-1-yl]pyridine-3-carbonitrile (PubChem CID 47299056) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[2-(3-methylphenyl)pyrrolidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[2-(3-methylphenyl)pyrrolidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 47299056 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[2-(3-methylphenyl)pyrrolidin-1-yl]pyridine-3-carbonitrile |
| SMILES | Cc1cccc(C2CCCN2c2ncccc2C#N)c1 |
| InChI | InChI=1S/C17H17N3/c1-13-5-2-6-14(11-13)16-8-4-10-20(16)17-15(12-18)7-3-9-19-17/h2-3,5-7,9,11,16H,4,8,10H2,1H3 |
| InChIKey | MXOWFKMWRXDMIH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |