C16H15N3 — CID 51313680
2-(2-phenylpyrrolidin-1-yl)pyridine-3-carbonitrile (PubChem CID 51313680) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-(2-phenylpyrrolidin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 2-(2-phenylpyrrolidin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 51313680 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-(2-phenylpyrrolidin-1-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCCC1c1ccccc1 |
| InChI | InChI=1S/C16H15N3/c17-12-14-8-4-10-18-16(14)19-11-5-9-15(19)13-6-2-1-3-7-13/h1-4,6-8,10,15H,5,9,11H2 |
| InChIKey | OZSCRCXLJRBERT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |