C19H21N3 — CID 133406762
2-[2-(2-phenylethyl)piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 133406762) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-[2-(2-phenylethyl)piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[2-(2-phenylethyl)piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133406762 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-[2-(2-phenylethyl)piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCCCC1CCc1ccccc1 |
| InChI | InChI=1S/C19H21N3/c20-15-17-9-6-13-21-19(17)22-14-5-4-10-18(22)12-11-16-7-2-1-3-8-16/h1-3,6-9,13,18H,4-5,10-12,14H2 |
| InChIKey | UCILYKWHKFOZKH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |