C18H22N2 — CID 133377119
2-[2-(3-phenylpropyl)pyrrolidin-1-yl]pyridine (PubChem CID 133377119) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[2-(3-phenylpropyl)pyrrolidin-1-yl]pyridine.
| Compound Name | 2-[2-(3-phenylpropyl)pyrrolidin-1-yl]pyridine |
|---|---|
| PubChem CID | 133377119 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2-[2-(3-phenylpropyl)pyrrolidin-1-yl]pyridine |
| SMILES | c1ccc(CCCC2CCCN2c2ccccn2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-2-8-16(9-3-1)10-6-11-17-12-7-15-20(17)18-13-4-5-14-19-18/h1-5,8-9,13-14,17H,6-7,10-12,15H2 |
| InChIKey | KNDXDCPQULOCSO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |