C16H28N2OSi — CID 177415257
tert-butyl-dimethyl-[[(2R)-1-pyridin-2-ylpyrrolidin-2-yl]methoxy]silane (PubChem CID 177415257) has the molecular formula C16H28N2OSi and a molecular weight of 292.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R)-1-pyridin-2-ylpyrrolidin-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R)-1-pyridin-2-ylpyrrolidin-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 177415257 |
| Molecular Formula | C16H28N2OSi |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R)-1-pyridin-2-ylpyrrolidin-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCCN1c1ccccn1 |
| InChI | InChI=1S/C16H28N2OSi/c1-16(2,3)20(4,5)19-13-14-9-8-12-18(14)15-10-6-7-11-17-15/h6-7,10-11,14H,8-9,12-13H2,1-5H3/t14-/m1/s1 |
| InChIKey | DCLXABZVLBQCGW-CQSZACIVSA-N |
| XLogP | 4.07 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|