C14H13N3S — CID 94173243
2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]pyridine-3-carbonitrile (PubChem CID 94173243) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is 2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 94173243 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C14H13N3S/c15-9-11-3-1-6-16-14(11)17-7-2-4-13(17)12-5-8-18-10-12/h1,3,5-6,8,10,13H,2,4,7H2/t13-/m1/s1 |
| InChIKey | FGUIVRQXNFRZLV-CYBMUJFWSA-N |
| XLogP | 3.36 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |