C17H18N2O2 — CID 122053185
6-[2-(3-methylphenyl)pyrrolidin-1-yl]pyridine-2-carboxylic acid (PubChem CID 122053185) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6-[2-(3-methylphenyl)pyrrolidin-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-[2-(3-methylphenyl)pyrrolidin-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122053185 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 6-[2-(3-methylphenyl)pyrrolidin-1-yl]pyridine-2-carboxylic acid |
| SMILES | Cc1cccc(C2CCCN2c2cccc(C(=O)O)n2)c1 |
| InChI | InChI=1S/C17H18N2O2/c1-12-5-2-6-13(11-12)15-8-4-10-19(15)16-9-3-7-14(18-16)17(20)21/h2-3,5-7,9,11,15H,4,8,10H2,1H3,(H,20,21) |
| InChIKey | NBHLFRDAVRUYDC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |