C20H23N — CID 134300269
2-(3-cyclopropylphenyl)-1-(3-methylphenyl)pyrrolidine (PubChem CID 134300269) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-(3-cyclopropylphenyl)-1-(3-methylphenyl)pyrrolidine.
| Compound Name | 2-(3-cyclopropylphenyl)-1-(3-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 134300269 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-(3-cyclopropylphenyl)-1-(3-methylphenyl)pyrrolidine |
| SMILES | Cc1cccc(N2CCCC2c2cccc(C3CC3)c2)c1 |
| InChI | InChI=1S/C20H23N/c1-15-5-2-8-19(13-15)21-12-4-9-20(21)18-7-3-6-17(14-18)16-10-11-16/h2-3,5-8,13-14,16,20H,4,9-12H2,1H3 |
| InChIKey | ANRNWCSQZUATAD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |