C16H18N2 — CID 138975238
2-methyl-4-(1-phenylpyrrolidin-2-yl)pyridine (PubChem CID 138975238) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-methyl-4-(1-phenylpyrrolidin-2-yl)pyridine.
| Compound Name | 2-methyl-4-(1-phenylpyrrolidin-2-yl)pyridine |
|---|---|
| PubChem CID | 138975238 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-methyl-4-(1-phenylpyrrolidin-2-yl)pyridine |
| SMILES | Cc1cc(C2CCCN2c2ccccc2)ccn1 |
| InChI | InChI=1S/C16H18N2/c1-13-12-14(9-10-17-13)16-8-5-11-18(16)15-6-3-2-4-7-15/h2-4,6-7,9-10,12,16H,5,8,11H2,1H3 |
| InChIKey | HNMKGDNQAXLCCX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |