C16H18ClN — CID 23512926
1,2-diphenylpyrrolidine;hydrochloride (PubChem CID 23512926) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is 1,2-diphenylpyrrolidine;hydrochloride.
| Compound Name | 1,2-diphenylpyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 23512926 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1,2-diphenylpyrrolidine;hydrochloride |
| SMILES | Cl.c1ccc(C2CCCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17N.ClH/c1-3-8-14(9-4-1)16-12-7-13-17(16)15-10-5-2-6-11-15;/h1-6,8-11,16H,7,12-13H2;1H |
| InChIKey | QAZOPXKKCZHVHH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |