C17H17F2NO2S — CID 133333664
1-[4-(difluoromethylsulfonyl)phenyl]-2-phenylpyrrolidine (PubChem CID 133333664) has the molecular formula C17H17F2NO2S and a molecular weight of 337.39 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)phenyl]-2-phenylpyrrolidine.
| Compound Name | 1-[4-(difluoromethylsulfonyl)phenyl]-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 133333664 |
| Molecular Formula | C17H17F2NO2S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)phenyl]-2-phenylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(N2CCCC2c2ccccc2)cc1)C(F)F |
| InChI | InChI=1S/C17H17F2NO2S/c18-17(19)23(21,22)15-10-8-14(9-11-15)20-12-4-7-16(20)13-5-2-1-3-6-13/h1-3,5-6,8-11,16-17H,4,7,12H2 |
| InChIKey | YMTCYQOSOKNEAJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |