C13H16ClF2NO2S — CID 63392122
2-(chloromethyl)-1-[4-(difluoromethylsulfonyl)phenyl]piperidine (PubChem CID 63392122) has the molecular formula C13H16ClF2NO2S and a molecular weight of 323.79 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[4-(difluoromethylsulfonyl)phenyl]piperidine.
| Compound Name | 2-(chloromethyl)-1-[4-(difluoromethylsulfonyl)phenyl]piperidine |
|---|---|
| PubChem CID | 63392122 |
| Molecular Formula | C13H16ClF2NO2S |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-(chloromethyl)-1-[4-(difluoromethylsulfonyl)phenyl]piperidine |
| SMILES | O=S(=O)(c1ccc(N2CCCCC2CCl)cc1)C(F)F |
| InChI | InChI=1S/C13H16ClF2NO2S/c14-9-11-3-1-2-8-17(11)10-4-6-12(7-5-10)20(18,19)13(15)16/h4-7,11,13H,1-3,8-9H2 |
| InChIKey | WHWMBAPXNJBEET-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|