C18H19F2NO3S — CID 133333515
1-[4-(difluoromethylsulfonyl)phenyl]-2-(3-methoxyphenyl)pyrrolidine (PubChem CID 133333515) has the molecular formula C18H19F2NO3S and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)phenyl]-2-(3-methoxyphenyl)pyrrolidine.
| Compound Name | 1-[4-(difluoromethylsulfonyl)phenyl]-2-(3-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 133333515 |
| Molecular Formula | C18H19F2NO3S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)phenyl]-2-(3-methoxyphenyl)pyrrolidine |
| SMILES | COc1cccc(C2CCCN2c2ccc(S(=O)(=O)C(F)F)cc2)c1 |
| InChI | InChI=1S/C18H19F2NO3S/c1-24-15-5-2-4-13(12-15)17-6-3-11-21(17)14-7-9-16(10-8-14)25(22,23)18(19)20/h2,4-5,7-10,12,17-18H,3,6,11H2,1H3 |
| InChIKey | LXJCMLOVFRJXOV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |