C18H18F2N2O4S — CID 133298219
1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-2-(3-methylphenyl)pyrrolidine (PubChem CID 133298219) has the molecular formula C18H18F2N2O4S and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-2-(3-methylphenyl)pyrrolidine.
| Compound Name | 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-2-(3-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 133298219 |
| Molecular Formula | C18H18F2N2O4S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-2-(3-methylphenyl)pyrrolidine |
| SMILES | Cc1cccc(C2CCCN2c2ccc(S(=O)(=O)C(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18F2N2O4S/c1-12-4-2-5-13(10-12)15-6-3-9-21(15)16-8-7-14(11-17(16)22(23)24)27(25,26)18(19)20/h2,4-5,7-8,10-11,15,18H,3,6,9H2,1H3 |
| InChIKey | YTSWOBSTGFOCRD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|