C19H21F2N3O5S — CID 133298013
1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-4-(4-methoxyphenyl)-1,4-diazepane (PubChem CID 133298013) has the molecular formula C19H21F2N3O5S and a molecular weight of 441.46 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-4-(4-methoxyphenyl)-1,4-diazepane.
| Compound Name | 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-4-(4-methoxyphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 133298013 |
| Molecular Formula | C19H21F2N3O5S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)-2-nitrophenyl]-4-(4-methoxyphenyl)-1,4-diazepane |
| SMILES | COc1ccc(N2CCCN(c3ccc(S(=O)(=O)C(F)F)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C19H21F2N3O5S/c1-29-15-5-3-14(4-6-15)22-9-2-10-23(12-11-22)17-8-7-16(13-18(17)24(25)26)30(27,28)19(20)21/h3-8,13,19H,2,9-12H2,1H3 |
| InChIKey | OCXBLWDOELLXJV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|