C25H28N4O5 — CID 98364921
(3aR,7aS)-2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 98364921) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is (3aR,7aS)-2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98364921 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (3aR,7aS)-2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | COc1ccc(N2CCN(c3ccc(N4C(=O)[C@H]5CCCC[C@H]5C4=O)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C25H28N4O5/c1-34-19-9-6-17(7-10-19)26-12-14-27(15-13-26)22-11-8-18(16-23(22)29(32)33)28-24(30)20-4-2-3-5-21(20)25(28)31/h6-11,16,20-21H,2-5,12-15H2,1H3/t20-,21+ |
| InChIKey | UOWJVFKDOJGQDT-OYRHEFFESA-N |
| XLogP | 3.61 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|