C20H23N3O3S2 — CID 4782582
1-[4-(1,3-dithiolan-2-yl)-2-nitrophenyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 4782582) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 1-[4-(1,3-dithiolan-2-yl)-2-nitrophenyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[4-(1,3-dithiolan-2-yl)-2-nitrophenyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 4782582 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 1-[4-(1,3-dithiolan-2-yl)-2-nitrophenyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(c3ccc(C4SCCS4)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-26-17-5-3-16(4-6-17)21-8-10-22(11-9-21)18-7-2-15(14-19(18)23(24)25)20-27-12-13-28-20/h2-7,14,20H,8-13H2,1H3 |
| InChIKey | ZFOZOQCCIOUOCZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|