C19H20N4O7 — CID 132593818
methyl 4-[4-(4-methoxyphenyl)piperazin-1-yl]-3,5-dinitrobenzoate (PubChem CID 132593818) has the molecular formula C19H20N4O7 and a molecular weight of 416.39 g/mol. Its IUPAC name is methyl 4-[4-(4-methoxyphenyl)piperazin-1-yl]-3,5-dinitrobenzoate.
| Compound Name | methyl 4-[4-(4-methoxyphenyl)piperazin-1-yl]-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 132593818 |
| Molecular Formula | C19H20N4O7 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | methyl 4-[4-(4-methoxyphenyl)piperazin-1-yl]-3,5-dinitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCN(c3ccc(OC)cc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N4O7/c1-29-15-5-3-14(4-6-15)20-7-9-21(10-8-20)18-16(22(25)26)11-13(19(24)30-2)12-17(18)23(27)28/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | ROQRWDHNJWPJGG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 128.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|