C23H27N3O6 — CID 55437017
dimethyl 5-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]benzene-1,3-dicarboxylate (PubChem CID 55437017) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is dimethyl 5-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55437017 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | dimethyl 5-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NCC(=O)N2CCN(c3ccc(OC)cc3)CC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H27N3O6/c1-30-20-6-4-19(5-7-20)25-8-10-26(11-9-25)21(27)15-24-18-13-16(22(28)31-2)12-17(14-18)23(29)32-3/h4-7,12-14,24H,8-11,15H2,1-3H3 |
| InChIKey | MOLAIBKUSLSOMN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|