C19H20F3N3O2 — CID 56502976
2-(3,5-difluoro-4-methoxyanilino)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 56502976) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-methoxyanilino)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3,5-difluoro-4-methoxyanilino)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 56502976 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-(3,5-difluoro-4-methoxyanilino)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | COc1c(F)cc(NCC(=O)N2CCN(c3ccc(F)cc3)CC2)cc1F |
| InChI | InChI=1S/C19H20F3N3O2/c1-27-19-16(21)10-14(11-17(19)22)23-12-18(26)25-8-6-24(7-9-25)15-4-2-13(20)3-5-15/h2-5,10-11,23H,6-9,12H2,1H3 |
| InChIKey | LEFZMTKHEDMMSB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|