ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate

C19H20N4O6 — CID 132593814

IUPACethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate
SMILESCCOC(=O)c1cc([N+](=O)[O-])c(N2CCN(c3ccccc3)CC2)c([N+](=O)[O-])c1
InChIInChI=1S/C19H20N4O6/c1-2-29-19(24)14-12-16(22(25)26)18(17(13-14)23(27)28)21-10-8-20(9-11-21)15-6-4-3-5-7-15/h3-7,12-13H,2,8-11H2,1H3
InChIKeyCWQYJDZKYSBMIW-UHFFFAOYSA-N
MW400.39 g/mol
LogP3.01
Rot. Bonds6

About ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate

ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate (PubChem CID 132593814) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate.

Molecular Properties

Compound Nameethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate
PubChem CID132593814
Molecular FormulaC19H20N4O6
Molecular Weight400.39 g/mol
Exact Mass400.14
IUPAC Nameethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate
SMILESCCOC(=O)c1cc([N+](=O)[O-])c(N2CCN(c3ccccc3)CC2)c([N+](=O)[O-])c1
InChIInChI=1S/C19H20N4O6/c1-2-29-19(24)14-12-16(22(25)26)18(17(13-14)23(27)28)21-10-8-20(9-11-21)15-6-4-3-5-7-15/h3-7,12-13H,2,8-11H2,1H3
InChIKeyCWQYJDZKYSBMIW-UHFFFAOYSA-N
XLogP3.01
TPSA119.06 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds6
Heavy Atoms29
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500400.39
LogP ≤ 53.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate?
The IUPAC name of ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate (CID 132593814) is ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate.
What is the SMILES notation for ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate?
The canonical SMILES for ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate is CCOC(=O)c1cc([N+](=O)[O-])c(N2CCN(c3ccccc3)CC2)c([N+](=O)[O-])c1.
What is the InChIKey of ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate?
The InChIKey is CWQYJDZKYSBMIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O6/c1-2-29-19(24)14-12-16(22(25)26)18(17(13-14)23(27)28)21-10-8-20(9-11-21)15-6-4-3-5-7-15/h3-7,12-13H,2,8-11H2,1H3.
What are the key properties of ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate?
ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate has a molecular weight of 400.39 g/mol, XLogP of 3.01, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate is sourced from PubChem (CID 132593814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).