C19H20N4O6 — CID 132593814
ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate (PubChem CID 132593814) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate.
| Compound Name | ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 132593814 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | ethyl 3,5-dinitro-4-(4-phenylpiperazin-1-yl)benzoate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])c(N2CCN(c3ccccc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N4O6/c1-2-29-19(24)14-12-16(22(25)26)18(17(13-14)23(27)28)21-10-8-20(9-11-21)15-6-4-3-5-7-15/h3-7,12-13H,2,8-11H2,1H3 |
| InChIKey | CWQYJDZKYSBMIW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|