C17H25N3O3 — CID 71145229
1-cyclohexyl-4-(4-methoxy-2-nitrophenyl)piperazine (PubChem CID 71145229) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-cyclohexyl-4-(4-methoxy-2-nitrophenyl)piperazine.
| Compound Name | 1-cyclohexyl-4-(4-methoxy-2-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 71145229 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-cyclohexyl-4-(4-methoxy-2-nitrophenyl)piperazine |
| SMILES | COc1ccc(N2CCN(C3CCCCC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H25N3O3/c1-23-15-7-8-16(17(13-15)20(21)22)19-11-9-18(10-12-19)14-5-3-2-4-6-14/h7-8,13-14H,2-6,9-12H2,1H3 |
| InChIKey | LFZSLXGECSBKOW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|