C17H21F2N3O5S — CID 133390818
1-(cyclopentylmethyl)-4-[4-(difluoromethylsulfonyl)-2-nitrophenyl]piperazin-2-one (PubChem CID 133390818) has the molecular formula C17H21F2N3O5S and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-4-[4-(difluoromethylsulfonyl)-2-nitrophenyl]piperazin-2-one.
| Compound Name | 1-(cyclopentylmethyl)-4-[4-(difluoromethylsulfonyl)-2-nitrophenyl]piperazin-2-one |
|---|---|
| PubChem CID | 133390818 |
| Molecular Formula | C17H21F2N3O5S |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 1-(cyclopentylmethyl)-4-[4-(difluoromethylsulfonyl)-2-nitrophenyl]piperazin-2-one |
| SMILES | O=C1CN(c2ccc(S(=O)(=O)C(F)F)cc2[N+](=O)[O-])CCN1CC1CCCC1 |
| InChI | InChI=1S/C17H21F2N3O5S/c18-17(19)28(26,27)13-5-6-14(15(9-13)22(24)25)20-7-8-21(16(23)11-20)10-12-3-1-2-4-12/h5-6,9,12,17H,1-4,7-8,10-11H2 |
| InChIKey | FAYQPNPQUHRZIA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|