C20H27N5O4S — CID 86888194
1-[4-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-3-nitrophenyl]sulfonylazepane (PubChem CID 86888194) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is 1-[4-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-3-nitrophenyl]sulfonylazepane.
| Compound Name | 1-[4-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-3-nitrophenyl]sulfonylazepane |
|---|---|
| PubChem CID | 86888194 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-[4-[2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-3-nitrophenyl]sulfonylazepane |
| SMILES | Cn1cc(C2CCCN2c2ccc(S(=O)(=O)N3CCCCCC3)cc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C20H27N5O4S/c1-22-15-16(14-21-22)18-7-6-12-24(18)19-9-8-17(13-20(19)25(26)27)30(28,29)23-10-4-2-3-5-11-23/h8-9,13-15,18H,2-7,10-12H2,1H3 |
| InChIKey | BURBQOOUOJOIRI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|