C22H25N5O4S2 — CID 40943313
2-[(2S)-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyrrolidin-2-yl]-1,3-benzothiazole (PubChem CID 40943313) has the molecular formula C22H25N5O4S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-[(2S)-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyrrolidin-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[(2S)-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyrrolidin-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 40943313 |
| Molecular Formula | C22H25N5O4S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 2-[(2S)-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyrrolidin-2-yl]-1,3-benzothiazole |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(N3CCC[C@H]3c3nc4ccccc4s3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H25N5O4S2/c1-24-11-13-25(14-12-24)33(30,31)16-8-9-18(20(15-16)27(28)29)26-10-4-6-19(26)22-23-17-5-2-3-7-21(17)32-22/h2-3,5,7-9,15,19H,4,6,10-14H2,1H3/t19-/m0/s1 |
| InChIKey | SISWGPNGEKKGDI-IBGZPJMESA-N |
| XLogP | 3.48 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|