C12H14BrF2NO2S — CID 80667640
2-(bromomethyl)-1-[4-(difluoromethylsulfonyl)phenyl]pyrrolidine (PubChem CID 80667640) has the molecular formula C12H14BrF2NO2S and a molecular weight of 354.22 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[4-(difluoromethylsulfonyl)phenyl]pyrrolidine.
| Compound Name | 2-(bromomethyl)-1-[4-(difluoromethylsulfonyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 80667640 |
| Molecular Formula | C12H14BrF2NO2S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 2-(bromomethyl)-1-[4-(difluoromethylsulfonyl)phenyl]pyrrolidine |
| SMILES | O=S(=O)(c1ccc(N2CCCC2CBr)cc1)C(F)F |
| InChI | InChI=1S/C12H14BrF2NO2S/c13-8-10-2-1-7-16(10)9-3-5-11(6-4-9)19(17,18)12(14)15/h3-6,10,12H,1-2,7-8H2 |
| InChIKey | HAIAQGIZBSCVME-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|