C14H19F2NO3S — CID 133274305
1-[4-(difluoromethylsulfonyl)phenyl]-3-ethoxypiperidine (PubChem CID 133274305) has the molecular formula C14H19F2NO3S and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)phenyl]-3-ethoxypiperidine.
| Compound Name | 1-[4-(difluoromethylsulfonyl)phenyl]-3-ethoxypiperidine |
|---|---|
| PubChem CID | 133274305 |
| Molecular Formula | C14H19F2NO3S |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)phenyl]-3-ethoxypiperidine |
| SMILES | CCOC1CCCN(c2ccc(S(=O)(=O)C(F)F)cc2)C1 |
| InChI | InChI=1S/C14H19F2NO3S/c1-2-20-12-4-3-9-17(10-12)11-5-7-13(8-6-11)21(18,19)14(15)16/h5-8,12,14H,2-4,9-10H2,1H3 |
| InChIKey | WEXXWGNDNFXJKW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |