C16H22F2N2O3S — CID 49431230
1-[4-(difluoromethylsulfonyl)phenyl]-N-propylpiperidine-3-carboxamide (PubChem CID 49431230) has the molecular formula C16H22F2N2O3S and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)phenyl]-N-propylpiperidine-3-carboxamide.
| Compound Name | 1-[4-(difluoromethylsulfonyl)phenyl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 49431230 |
| Molecular Formula | C16H22F2N2O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)phenyl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)C1CCCN(c2ccc(S(=O)(=O)C(F)F)cc2)C1 |
| InChI | InChI=1S/C16H22F2N2O3S/c1-2-9-19-15(21)12-4-3-10-20(11-12)13-5-7-14(8-6-13)24(22,23)16(17)18/h5-8,12,16H,2-4,9-11H2,1H3,(H,19,21) |
| InChIKey | YBNADTYXMHCTIT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |