C16H26N4OS — CID 96538691
(3R)-1-(6-propan-2-ylsulfanylpyridazin-3-yl)-N-propylpiperidine-3-carboxamide (PubChem CID 96538691) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is (3R)-1-(6-propan-2-ylsulfanylpyridazin-3-yl)-N-propylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-(6-propan-2-ylsulfanylpyridazin-3-yl)-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 96538691 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (3R)-1-(6-propan-2-ylsulfanylpyridazin-3-yl)-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1CCCN(c2ccc(SC(C)C)nn2)C1 |
| InChI | InChI=1S/C16H26N4OS/c1-4-9-17-16(21)13-6-5-10-20(11-13)14-7-8-15(19-18-14)22-12(2)3/h7-8,12-13H,4-6,9-11H2,1-3H3,(H,17,21)/t13-/m1/s1 |
| InChIKey | SAVDESHRWJYIPW-CYBMUJFWSA-N |
| XLogP | 2.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |