C14H16F2N2O4S — CID 51152969
N-[2-(cyclopropanecarbonylamino)ethyl]-4-(difluoromethylsulfonyl)benzamide (PubChem CID 51152969) has the molecular formula C14H16F2N2O4S and a molecular weight of 346.36 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonylamino)ethyl]-4-(difluoromethylsulfonyl)benzamide.
| Compound Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-(difluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 51152969 |
| Molecular Formula | C14H16F2N2O4S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-(difluoromethylsulfonyl)benzamide |
| SMILES | O=C(NCCNC(=O)C1CC1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H16F2N2O4S/c15-14(16)23(21,22)11-5-3-10(4-6-11)13(20)18-8-7-17-12(19)9-1-2-9/h3-6,9,14H,1-2,7-8H2,(H,17,19)(H,18,20) |
| InChIKey | WYSWJUGKDGBENE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|