C13H15F2NO5S — CID 9404633
methyl 4-[[4-(difluoromethylsulfonyl)benzoyl]amino]butanoate (PubChem CID 9404633) has the molecular formula C13H15F2NO5S and a molecular weight of 335.33 g/mol. Its IUPAC name is methyl 4-[[4-(difluoromethylsulfonyl)benzoyl]amino]butanoate.
| Compound Name | methyl 4-[[4-(difluoromethylsulfonyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 9404633 |
| Molecular Formula | C13H15F2NO5S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | methyl 4-[[4-(difluoromethylsulfonyl)benzoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C13H15F2NO5S/c1-21-11(17)3-2-8-16-12(18)9-4-6-10(7-5-9)22(19,20)13(14)15/h4-7,13H,2-3,8H2,1H3,(H,16,18) |
| InChIKey | GATAAYBDFNHFID-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|