C20H24N2O6S — CID 18109760
methyl 4-[[4-[(4-ethoxyphenyl)sulfamoyl]benzoyl]amino]butanoate (PubChem CID 18109760) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is methyl 4-[[4-[(4-ethoxyphenyl)sulfamoyl]benzoyl]amino]butanoate.
| Compound Name | methyl 4-[[4-[(4-ethoxyphenyl)sulfamoyl]benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 18109760 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | methyl 4-[[4-[(4-ethoxyphenyl)sulfamoyl]benzoyl]amino]butanoate |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(C(=O)NCCCC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O6S/c1-3-28-17-10-8-16(9-11-17)22-29(25,26)18-12-6-15(7-13-18)20(24)21-14-4-5-19(23)27-2/h6-13,22H,3-5,14H2,1-2H3,(H,21,24) |
| InChIKey | SIDFBRMPQODEML-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|