C21H23N3O5S — CID 55362498
4-[(4-ethoxyphenyl)sulfonylamino]-N-[3-oxo-3-(prop-2-ynylamino)propyl]benzamide (PubChem CID 55362498) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-[(4-ethoxyphenyl)sulfonylamino]-N-[3-oxo-3-(prop-2-ynylamino)propyl]benzamide.
| Compound Name | 4-[(4-ethoxyphenyl)sulfonylamino]-N-[3-oxo-3-(prop-2-ynylamino)propyl]benzamide |
|---|---|
| PubChem CID | 55362498 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 4-[(4-ethoxyphenyl)sulfonylamino]-N-[3-oxo-3-(prop-2-ynylamino)propyl]benzamide |
| SMILES | C#CCNC(=O)CCNC(=O)c1ccc(NS(=O)(=O)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O5S/c1-3-14-22-20(25)13-15-23-21(26)16-5-7-17(8-6-16)24-30(27,28)19-11-9-18(10-12-19)29-4-2/h1,5-12,24H,4,13-15H2,2H3,(H,22,25)(H,23,26) |
| InChIKey | JOXWEKVAVRSNOP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|