C11H15NO4S — CID 91451326
4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]benzenesulfonic acid (PubChem CID 91451326) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]benzenesulfonic acid.
| Compound Name | 4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91451326 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(N2CCC[C@H]2CO)cc1 |
| InChI | InChI=1S/C11H15NO4S/c13-8-10-2-1-7-12(10)9-3-5-11(6-4-9)17(14,15)16/h3-6,10,13H,1-2,7-8H2,(H,14,15,16)/t10-/m0/s1 |
| InChIKey | LGVQJRCCVZUPME-JTQLQIEISA-N |
| XLogP | 0.89 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|