C11H15N3O3 — CID 69218686
[(2S)-1-(3-amino-4-nitrophenyl)pyrrolidin-2-yl]methanol (PubChem CID 69218686) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is [(2S)-1-(3-amino-4-nitrophenyl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-(3-amino-4-nitrophenyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 69218686 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | [(2S)-1-(3-amino-4-nitrophenyl)pyrrolidin-2-yl]methanol |
| SMILES | Nc1cc(N2CCC[C@H]2CO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N3O3/c12-10-6-8(3-4-11(10)14(16)17)13-5-1-2-9(13)7-15/h3-4,6,9,15H,1-2,5,7,12H2/t9-/m0/s1 |
| InChIKey | OTGXJFSCJBPVSQ-VIFPVBQESA-N |
| XLogP | 1.14 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|