C12H17NO3 — CID 68535089
4-[2-(hydroxymethyl)piperidin-1-yl]benzene-1,2-diol (PubChem CID 68535089) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-[2-(hydroxymethyl)piperidin-1-yl]benzene-1,2-diol.
| Compound Name | 4-[2-(hydroxymethyl)piperidin-1-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 68535089 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-[2-(hydroxymethyl)piperidin-1-yl]benzene-1,2-diol |
| SMILES | OCC1CCCCN1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H17NO3/c14-8-10-3-1-2-6-13(10)9-4-5-11(15)12(16)7-9/h4-5,7,10,14-16H,1-3,6,8H2 |
| InChIKey | CCQAZEOGHKRQKW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|