C14H21NO3 — CID 117028012
[1-(3,4-dimethoxyphenyl)piperidin-2-yl]methanol (PubChem CID 117028012) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)piperidin-2-yl]methanol.
| Compound Name | [1-(3,4-dimethoxyphenyl)piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 117028012 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)piperidin-2-yl]methanol |
| SMILES | COc1ccc(N2CCCCC2CO)cc1OC |
| InChI | InChI=1S/C14H21NO3/c1-17-13-7-6-11(9-14(13)18-2)15-8-4-3-5-12(15)10-16/h6-7,9,12,16H,3-5,8,10H2,1-2H3 |
| InChIKey | FYUIHBJIXMIYKW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|