C22H28ClNO3 — CID 123595312
3-[3-[2-chloro-5-[2-(hydroxymethyl)piperidin-1-yl]phenyl]-4-methoxyphenyl]propan-1-ol (PubChem CID 123595312) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is 3-[3-[2-chloro-5-[2-(hydroxymethyl)piperidin-1-yl]phenyl]-4-methoxyphenyl]propan-1-ol.
| Compound Name | 3-[3-[2-chloro-5-[2-(hydroxymethyl)piperidin-1-yl]phenyl]-4-methoxyphenyl]propan-1-ol |
|---|---|
| PubChem CID | 123595312 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 3-[3-[2-chloro-5-[2-(hydroxymethyl)piperidin-1-yl]phenyl]-4-methoxyphenyl]propan-1-ol |
| SMILES | COc1ccc(CCCO)cc1-c1cc(N2CCCCC2CO)ccc1Cl |
| InChI | InChI=1S/C22H28ClNO3/c1-27-22-10-7-16(5-4-12-25)13-20(22)19-14-17(8-9-21(19)23)24-11-3-2-6-18(24)15-26/h7-10,13-14,18,25-26H,2-6,11-12,15H2,1H3 |
| InChIKey | VFMSGBXOVNEWJO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |