C18H20ClNO — CID 163391622
1-[[4-chloro-3-(2-methoxyphenyl)phenyl]methyl]pyrrolidine (PubChem CID 163391622) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 1-[[4-chloro-3-(2-methoxyphenyl)phenyl]methyl]pyrrolidine.
| Compound Name | 1-[[4-chloro-3-(2-methoxyphenyl)phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 163391622 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-[[4-chloro-3-(2-methoxyphenyl)phenyl]methyl]pyrrolidine |
| SMILES | COc1ccccc1-c1cc(CN2CCCC2)ccc1Cl |
| InChI | InChI=1S/C18H20ClNO/c1-21-18-7-3-2-6-15(18)16-12-14(8-9-17(16)19)13-20-10-4-5-11-20/h2-3,6-9,12H,4-5,10-11,13H2,1H3 |
| InChIKey | TWOLBTAMQGCPAE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |