C21H25NO4 — CID 141157601
2-[1-(3,4-dimethoxyphenyl)pyrrolidin-2-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 141157601) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)pyrrolidin-2-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)pyrrolidin-2-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 141157601 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)pyrrolidin-2-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CC2CCCN2c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H25NO4/c1-24-18-9-6-15(7-10-18)19(23)13-16-5-4-12-22(16)17-8-11-20(25-2)21(14-17)26-3/h6-11,14,16H,4-5,12-13H2,1-3H3 |
| InChIKey | VHTVDCJEXNDBQV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|