C24H30O6 — CID 160718858
2-[(1S,2R)-2-hydroxycyclopentyl]-1-[3-methoxy-4-[2-[(4-methoxyphenyl)methoxy]ethoxy]phenyl]ethanone (PubChem CID 160718858) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[(1S,2R)-2-hydroxycyclopentyl]-1-[3-methoxy-4-[2-[(4-methoxyphenyl)methoxy]ethoxy]phenyl]ethanone.
| Compound Name | 2-[(1S,2R)-2-hydroxycyclopentyl]-1-[3-methoxy-4-[2-[(4-methoxyphenyl)methoxy]ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 160718858 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-[(1S,2R)-2-hydroxycyclopentyl]-1-[3-methoxy-4-[2-[(4-methoxyphenyl)methoxy]ethoxy]phenyl]ethanone |
| SMILES | COc1ccc(COCCOc2ccc(C(=O)C[C@@H]3CCC[C@H]3O)cc2OC)cc1 |
| InChI | InChI=1S/C24H30O6/c1-27-20-9-6-17(7-10-20)16-29-12-13-30-23-11-8-19(15-24(23)28-2)22(26)14-18-4-3-5-21(18)25/h6-11,15,18,21,25H,3-5,12-14,16H2,1-2H3/t18-,21+/m0/s1 |
| InChIKey | CIHMPOVMGHGYPY-GHTZIAJQSA-N |
| XLogP | 4.03 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|