C11H14FNO — CID 173099689
[(2R)-1-(3-fluorophenyl)pyrrolidin-2-yl]methanol (PubChem CID 173099689) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is [(2R)-1-(3-fluorophenyl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-(3-fluorophenyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 173099689 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | [(2R)-1-(3-fluorophenyl)pyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCN1c1cccc(F)c1 |
| InChI | InChI=1S/C11H14FNO/c12-9-3-1-4-10(7-9)13-6-2-5-11(13)8-14/h1,3-4,7,11,14H,2,5-6,8H2/t11-/m1/s1 |
| InChIKey | XHPLQIAHENXCFC-LLVKDONJSA-N |
| XLogP | 1.79 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |