C17H16F2N2O3 — CID 133333712
1-[3-(difluoromethoxy)-4-nitrophenyl]-2-phenylpyrrolidine (PubChem CID 133333712) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)-4-nitrophenyl]-2-phenylpyrrolidine.
| Compound Name | 1-[3-(difluoromethoxy)-4-nitrophenyl]-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 133333712 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-[3-(difluoromethoxy)-4-nitrophenyl]-2-phenylpyrrolidine |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC2c2ccccc2)cc1OC(F)F |
| InChI | InChI=1S/C17H16F2N2O3/c18-17(19)24-16-11-13(8-9-15(16)21(22)23)20-10-4-7-14(20)12-5-2-1-3-6-12/h1-3,5-6,8-9,11,14,17H,4,7,10H2 |
| InChIKey | MJMQROPHPUCOMW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|