C15H16F2N2O5 — CID 122063493
(3aS,6aR)-2-[3-(difluoromethoxy)-4-nitrophenyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122063493) has the molecular formula C15H16F2N2O5 and a molecular weight of 342.30 g/mol. Its IUPAC name is (3aS,6aR)-2-[3-(difluoromethoxy)-4-nitrophenyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[3-(difluoromethoxy)-4-nitrophenyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122063493 |
| Molecular Formula | C15H16F2N2O5 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (3aS,6aR)-2-[3-(difluoromethoxy)-4-nitrophenyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(c1ccc([N+](=O)[O-])c(OC(F)F)c1)C2 |
| InChI | InChI=1S/C15H16F2N2O5/c16-14(17)24-12-6-10(3-4-11(12)19(22)23)18-7-9-2-1-5-15(9,8-18)13(20)21/h3-4,6,9,14H,1-2,5,7-8H2,(H,20,21)/t9-,15+/m0/s1 |
| InChIKey | VZRNDWKMDCSLHY-BJOHPYRUSA-N |
| XLogP | 2.89 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|