C15H16F2N2O3 — CID 133322988
2-[3-(difluoromethoxy)-4-nitrophenyl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 133322988) has the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-4-nitrophenyl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | 2-[3-(difluoromethoxy)-4-nitrophenyl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 133322988 |
| Molecular Formula | C15H16F2N2O3 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[3-(difluoromethoxy)-4-nitrophenyl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | O=[N+]([O-])c1ccc(N2CC3CC=CCC3C2)cc1OC(F)F |
| InChI | InChI=1S/C15H16F2N2O3/c16-15(17)22-14-7-12(5-6-13(14)19(20)21)18-8-10-3-1-2-4-11(10)9-18/h1-2,5-7,10-11,15H,3-4,8-9H2 |
| InChIKey | JLDJUHXORNHXQD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|