C16H17F2N5O3 — CID 133458709
4-[4-[3-(difluoromethoxy)-4-nitrophenyl]piperazin-1-yl]-2-methylpyrimidine (PubChem CID 133458709) has the molecular formula C16H17F2N5O3 and a molecular weight of 365.34 g/mol. Its IUPAC name is 4-[4-[3-(difluoromethoxy)-4-nitrophenyl]piperazin-1-yl]-2-methylpyrimidine.
| Compound Name | 4-[4-[3-(difluoromethoxy)-4-nitrophenyl]piperazin-1-yl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 133458709 |
| Molecular Formula | C16H17F2N5O3 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 4-[4-[3-(difluoromethoxy)-4-nitrophenyl]piperazin-1-yl]-2-methylpyrimidine |
| SMILES | Cc1nccc(N2CCN(c3ccc([N+](=O)[O-])c(OC(F)F)c3)CC2)n1 |
| InChI | InChI=1S/C16H17F2N5O3/c1-11-19-5-4-15(20-11)22-8-6-21(7-9-22)12-2-3-13(23(24)25)14(10-12)26-16(17)18/h2-5,10,16H,6-9H2,1H3 |
| InChIKey | ZYVDIPBJTSBKKB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|